C46H75NS — CID 44537953
(6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidine (PubChem CID 44537953) has the molecular formula C46H75NS and a molecular weight of 674.18 g/mol. Its IUPAC name is (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidine.
| Compound Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidine |
|---|---|
| PubChem CID | 44537953 |
| Molecular Formula | C46H75NS |
| Molecular Weight | 674.18 g/mol |
| Exact Mass | 673.56 |
| IUPAC Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene;1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C.C[C@H]1CCCC[C@@]1(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C30H50.C16H25NS/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4;1-14-8-3-4-10-16(14,15-9-7-13-18-15)17-11-5-2-6-12-17/h15-18,23-24H,9-14,19-22H2,1-8H3;7,9,13-14H,2-6,8,10-12H2,1H3/b27-17+,28-18+,29-23+,30-24+;/t;14-,16+/m.0/s1 |
| InChIKey | QEIWZWBZRYSZLB-VJCSBYGWSA-N |
| XLogP | 15.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.18 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|