C16H25NOS — CID 15103557
[(1R,2S)-2-piperidin-1-yl-2-thiophen-2-ylcyclohexyl]methanol (PubChem CID 15103557) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is [(1R,2S)-2-piperidin-1-yl-2-thiophen-2-ylcyclohexyl]methanol.
| Compound Name | [(1R,2S)-2-piperidin-1-yl-2-thiophen-2-ylcyclohexyl]methanol |
|---|---|
| PubChem CID | 15103557 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | [(1R,2S)-2-piperidin-1-yl-2-thiophen-2-ylcyclohexyl]methanol |
| SMILES | OC[C@@H]1CCCC[C@]1(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C16H25NOS/c18-13-14-7-2-3-9-16(14,15-8-6-12-19-15)17-10-4-1-5-11-17/h6,8,12,14,18H,1-5,7,9-11,13H2/t14-,16-/m0/s1 |
| InChIKey | KYQAMIUXCFTIHP-HOCLYGCPSA-N |
| XLogP | 3.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |