C18H27NS — CID 67624546
1-[(1S,2R)-2-prop-2-enyl-1-thiophen-2-ylcyclohexyl]piperidine (PubChem CID 67624546) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is 1-[(1S,2R)-2-prop-2-enyl-1-thiophen-2-ylcyclohexyl]piperidine.
| Compound Name | 1-[(1S,2R)-2-prop-2-enyl-1-thiophen-2-ylcyclohexyl]piperidine |
|---|---|
| PubChem CID | 67624546 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[(1S,2R)-2-prop-2-enyl-1-thiophen-2-ylcyclohexyl]piperidine |
| SMILES | C=CC[C@H]1CCCC[C@]1(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C18H27NS/c1-2-9-16-10-4-5-12-18(16,17-11-8-15-20-17)19-13-6-3-7-14-19/h2,8,11,15-16H,1,3-7,9-10,12-14H2/t16-,18-/m0/s1 |
| InChIKey | LHMDFROFROLBFT-WMZOPIPTSA-N |
| XLogP | 5.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|