C16H26O — CID 12619393
2-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclohexan-1-one (PubChem CID 12619393) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclohexan-1-one.
| Compound Name | 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 12619393 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclohexan-1-one |
| SMILES | CC(C)=CCC/C(C)=C\CC1CCCCC1=O |
| InChI | InChI=1S/C16H26O/c1-13(2)7-6-8-14(3)11-12-15-9-4-5-10-16(15)17/h7,11,15H,4-6,8-10,12H2,1-3H3/b14-11- |
| InChIKey | BIIBCCSKYKIWEF-KAMYIIQDSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|