C20H32O3 — CID 54276647
3-hexadeca-7,10-dienyl-2-hydroxy-2H-furan-5-one (PubChem CID 54276647) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 3-hexadeca-7,10-dienyl-2-hydroxy-2H-furan-5-one.
| Compound Name | 3-hexadeca-7,10-dienyl-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 54276647 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 3-hexadeca-7,10-dienyl-2-hydroxy-2H-furan-5-one |
| SMILES | CCCCCC=CCC=CCCCCCCC1=CC(=O)OC1O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-17-19(21)23-20(18)22/h6-7,9-10,17,20,22H,2-5,8,11-16H2,1H3 |
| InChIKey | RNWMRPQPUVPJFK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|