C24H41NO3 — CID 135163844
(9E,12Z)-N-[(3S,4S,5R)-4,5-dimethyl-2-oxooxolan-3-yl]octadeca-9,12-dienamide (PubChem CID 135163844) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is (9E,12Z)-N-[(3S,4S,5R)-4,5-dimethyl-2-oxooxolan-3-yl]octadeca-9,12-dienamide.
| Compound Name | (9E,12Z)-N-[(3S,4S,5R)-4,5-dimethyl-2-oxooxolan-3-yl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 135163844 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (9E,12Z)-N-[(3S,4S,5R)-4,5-dimethyl-2-oxooxolan-3-yl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C/CCCCCCCC(=O)N[C@@H]1C(=O)O[C@H](C)[C@H]1C |
| InChI | InChI=1S/C24H41NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)25-23-20(2)21(3)28-24(23)27/h8-9,11-12,20-21,23H,4-7,10,13-19H2,1-3H3,(H,25,26)/b9-8-,12-11+/t20-,21-,23+/m1/s1 |
| InChIKey | COSDRKOYVFZQGC-SXYSTCLWSA-N |
| XLogP | 5.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|