C40H70N2O — CID 89399914
(9Z,12Z)-N-[(1S,2R)-2-[[(10Z,13Z)-nonadeca-1,10,13-trien-2-yl]amino]cyclopropyl]octadeca-9,12-dienamide (PubChem CID 89399914) has the molecular formula C40H70N2O and a molecular weight of 595.01 g/mol. Its IUPAC name is (9Z,12Z)-N-[(1S,2R)-2-[[(10Z,13Z)-nonadeca-1,10,13-trien-2-yl]amino]cyclopropyl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[(1S,2R)-2-[[(10Z,13Z)-nonadeca-1,10,13-trien-2-yl]amino]cyclopropyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 89399914 |
| Molecular Formula | C40H70N2O |
| Molecular Weight | 595.01 g/mol |
| Exact Mass | 594.55 |
| IUPAC Name | (9Z,12Z)-N-[(1S,2R)-2-[[(10Z,13Z)-nonadeca-1,10,13-trien-2-yl]amino]cyclopropyl]octadeca-9,12-dienamide |
| SMILES | C=C(CCCCCCC/C=C\C/C=C\CCCCC)N[C@@H]1C[C@@H]1NC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C40H70N2O/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37(3)41-38-36-39(38)42-40(43)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,38-39,41H,3-11,16-17,22-36H2,1-2H3,(H,42,43)/b14-12-,15-13-,20-18-,21-19-/t38-,39+/m1/s1 |
| InChIKey | TWXVCACCUVOOBM-HQVUBJNGSA-N |
| XLogP | 11.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.01 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|