C20H35NO3 — CID 11638617
(E)-N-[(3S)-2-oxooxolan-3-yl]hexadec-8-enamide (PubChem CID 11638617) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (E)-N-[(3S)-2-oxooxolan-3-yl]hexadec-8-enamide.
| Compound Name | (E)-N-[(3S)-2-oxooxolan-3-yl]hexadec-8-enamide |
|---|---|
| PubChem CID | 11638617 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (E)-N-[(3S)-2-oxooxolan-3-yl]hexadec-8-enamide |
| SMILES | CCCCCCC/C=C/CCCCCCC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C20H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)21-18-16-17-24-20(18)23/h8-9,18H,2-7,10-17H2,1H3,(H,21,22)/b9-8+/t18-/m0/s1 |
| InChIKey | DUDRZWGXCCVZPL-BLGFXRMMSA-N |
| XLogP | 4.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|