C36H62N2O7 — CID 157320754
(Z)-3-hydroxy-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide;(Z)-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide (PubChem CID 157320754) has the molecular formula C36H62N2O7 and a molecular weight of 634.90 g/mol. Its IUPAC name is (Z)-3-hydroxy-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide;(Z)-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide.
| Compound Name | (Z)-3-hydroxy-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide;(Z)-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide |
|---|---|
| PubChem CID | 157320754 |
| Molecular Formula | C36H62N2O7 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.46 |
| IUPAC Name | (Z)-3-hydroxy-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide;(Z)-N-[(3S)-2-oxooxolan-3-yl]tetradec-7-enamide |
| SMILES | CCCCCC/C=C\CCCC(O)CC(=O)N[C@H]1CCOC1=O.CCCCCC/C=C\CCCCCC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C18H31NO4.C18H31NO3/c1-2-3-4-5-6-7-8-9-10-11-15(20)14-17(21)19-16-12-13-23-18(16)22;1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)19-16-14-15-22-18(16)21/h7-8,15-16,20H,2-6,9-14H2,1H3,(H,19,21);7-8,16H,2-6,9-15H2,1H3,(H,19,20)/b2*8-7-/t15?,16-;16-/m00/s1 |
| InChIKey | BEDDCYSNNJNNOI-ILZQVVSESA-N |
| XLogP | 6.76 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|