C16H25FO2 — CID 145154298
fluoro (E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enoate (PubChem CID 145154298) has the molecular formula C16H25FO2 and a molecular weight of 268.37 g/mol. Its IUPAC name is fluoro (E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enoate.
| Compound Name | fluoro (E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enoate |
|---|---|
| PubChem CID | 145154298 |
| Molecular Formula | C16H25FO2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | fluoro (E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enoate |
| SMILES | CC1=C(CC/C(C)=C/CC(=O)OF)C(C)(C)CCC1 |
| InChI | InChI=1S/C16H25FO2/c1-12(8-10-15(18)19-17)7-9-14-13(2)6-5-11-16(14,3)4/h8H,5-7,9-11H2,1-4H3/b12-8+ |
| InChIKey | UJSJCIFNKQPIMV-XYOKQWHBSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|