C67H104O6 — CID 164980667
bis([(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate);[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] propanoate (PubChem CID 164980667) has the molecular formula C67H104O6 and a molecular weight of 1005.56 g/mol. Its IUPAC name is bis([(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate);[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] propanoate.
| Compound Name | bis([(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate);[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] propanoate |
|---|---|
| PubChem CID | 164980667 |
| Molecular Formula | C67H104O6 |
| Molecular Weight | 1005.56 g/mol |
| Exact Mass | 1004.78 |
| IUPAC Name | bis([(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate);[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] propanoate |
| SMILES | CC(=O)OC/C=C(C)/C=C/C=C(\C)CCC1=C(C)CCCC1(C)C.CC(=O)OC/C=C(C)/C=C/C=C(\C)CCC1=C(C)CCCC1(C)C.CCC(=O)OC/C=C(C)/C=C/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H36O2.2C22H34O2/c1-7-22(24)25-17-15-19(3)11-8-10-18(2)13-14-21-20(4)12-9-16-23(21,5)6;2*1-17(9-7-10-18(2)14-16-24-20(4)23)12-13-21-19(3)11-8-15-22(21,5)6/h8,10-11,15H,7,9,12-14,16-17H2,1-6H3;2*7,9-10,14H,8,11-13,15-16H2,1-6H3/b11-8+,18-10+,19-15+;2*10-7+,17-9+,18-14+ |
| InChIKey | FKYMCXKOOXKGHR-BVKHKLBVSA-N |
| XLogP | 19.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.56 |
| LogP ≤ 5 | 19.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|