C18H30I2O2 — CID 91120791
[3-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl] acetate;molecular iodine (PubChem CID 91120791) has the molecular formula C18H30I2O2 and a molecular weight of 532.24 g/mol. Its IUPAC name is [3-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl] acetate;molecular iodine.
| Compound Name | [3-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl] acetate;molecular iodine |
|---|---|
| PubChem CID | 91120791 |
| Molecular Formula | C18H30I2O2 |
| Molecular Weight | 532.24 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | [3-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl] acetate;molecular iodine |
| SMILES | CC(=O)OCC=C(C)CCCC1=C(C)CCCC1(C)C.II |
| InChI | InChI=1S/C18H30O2.I2/c1-14(11-13-20-16(3)19)8-6-10-17-15(2)9-7-12-18(17,4)5;1-2/h11H,6-10,12-13H2,1-5H3; |
| InChIKey | UUHIFUQYXRZHPL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.24 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|