C15H20O5 — CID 101039080
(2Z)-2-[3-hydroxy-3-(2-hydroxy-5-oxo-2H-furan-3-yl)propylidene]-6-methylhept-5-enal (PubChem CID 101039080) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2Z)-2-[3-hydroxy-3-(2-hydroxy-5-oxo-2H-furan-3-yl)propylidene]-6-methylhept-5-enal.
| Compound Name | (2Z)-2-[3-hydroxy-3-(2-hydroxy-5-oxo-2H-furan-3-yl)propylidene]-6-methylhept-5-enal |
|---|---|
| PubChem CID | 101039080 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2Z)-2-[3-hydroxy-3-(2-hydroxy-5-oxo-2H-furan-3-yl)propylidene]-6-methylhept-5-enal |
| SMILES | CC(C)=CCC/C(C=O)=C/CC(O)C1=CC(=O)OC1O |
| InChI | InChI=1S/C15H20O5/c1-10(2)4-3-5-11(9-16)6-7-13(17)12-8-14(18)20-15(12)19/h4,6,8-9,13,15,17,19H,3,5,7H2,1-2H3/b11-6- |
| InChIKey | QKCSIMGJPVINON-WDZFZDKYSA-N |
| XLogP | 1.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|