C24H36O4 — CID 134836350
(2R)-2-hydroxy-3-[(1R)-1-hydroxy-2-[1,2,5-trimethyl-5-(3-methylbut-3-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 134836350) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[(1R)-1-hydroxy-2-[1,2,5-trimethyl-5-(3-methylbut-3-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | (2R)-2-hydroxy-3-[(1R)-1-hydroxy-2-[1,2,5-trimethyl-5-(3-methylbut-3-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 134836350 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (2R)-2-hydroxy-3-[(1R)-1-hydroxy-2-[1,2,5-trimethyl-5-(3-methylbut-3-enyl)-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | C=C(C)CCC1(C)CCCC2C1=CCC(C)C2(C)C[C@@H](O)C1=CC(=O)O[C@H]1O |
| InChI | InChI=1S/C24H36O4/c1-15(2)10-12-23(4)11-6-7-19-18(23)9-8-16(3)24(19,5)14-20(25)17-13-21(26)28-22(17)27/h9,13,16,19-20,22,25,27H,1,6-8,10-12,14H2,2-5H3/t16?,19?,20-,22-,23?,24?/m1/s1 |
| InChIKey | ZOQOZPQFNVOWPK-BNMJDJHSSA-N |
| XLogP | 4.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|