C25H36O3 — CID 162987373
(2S)-3-[(E)-2-[(1R,2S,4aR,4bS,10aS)-1,2,4a,8,8-pentamethyl-3,4,4b,5,6,7,10,10a-octahydro-2H-phenanthren-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one (PubChem CID 162987373) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (2S)-3-[(E)-2-[(1R,2S,4aR,4bS,10aS)-1,2,4a,8,8-pentamethyl-3,4,4b,5,6,7,10,10a-octahydro-2H-phenanthren-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one.
| Compound Name | (2S)-3-[(E)-2-[(1R,2S,4aR,4bS,10aS)-1,2,4a,8,8-pentamethyl-3,4,4b,5,6,7,10,10a-octahydro-2H-phenanthren-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 162987373 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (2S)-3-[(E)-2-[(1R,2S,4aR,4bS,10aS)-1,2,4a,8,8-pentamethyl-3,4,4b,5,6,7,10,10a-octahydro-2H-phenanthren-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one |
| SMILES | C[C@H]1CC[C@@]2(C)[C@@H]3CCCC(C)(C)C3=CC[C@@H]2[C@@]1(C)/C=C/C1=CC(=O)O[C@@H]1O |
| InChI | InChI=1S/C25H36O3/c1-16-10-13-25(5)19-7-6-12-23(2,3)18(19)8-9-20(25)24(16,4)14-11-17-15-21(26)28-22(17)27/h8,11,14-16,19-20,22,27H,6-7,9-10,12-13H2,1-5H3/b14-11+/t16-,19+,20+,22-,24-,25-/m0/s1 |
| InChIKey | IIKDZJWOARGMCV-UXOLBWRYSA-N |
| XLogP | 5.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|