About 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one
4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one (PubChem CID 86049416) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one.
Analyze 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one?
The IUPAC name of 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one (CID 86049416) is 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one.
What is the SMILES notation for 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one?
The canonical SMILES for 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one is CC1(C)CCCC2OC(=O)C=C21.
What is the InChIKey of 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one?
The InChIKey is MIHCGTGXFQDFEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-10(2)5-3-4-8-7(10)6-9(11)12-8/h6,8H,3-5H2,1-2H3.
What are the key properties of 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one?
4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one has a molecular weight of 166.22 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2-one is sourced from PubChem (CID 86049416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).