C23H25NO3 — CID 146683213
(1S,2R,5S,10S,13S)-10-hydroxy-1,2-dimethyl-6-oxa-22-azahexacyclo[11.10.0.02,10.05,9.015,23.016,21]tricosa-8,15(23),16,18,20-pentaen-7-one (PubChem CID 146683213) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (1S,2R,5S,10S,13S)-10-hydroxy-1,2-dimethyl-6-oxa-22-azahexacyclo[11.10.0.02,10.05,9.015,23.016,21]tricosa-8,15(23),16,18,20-pentaen-7-one.
| Compound Name | (1S,2R,5S,10S,13S)-10-hydroxy-1,2-dimethyl-6-oxa-22-azahexacyclo[11.10.0.02,10.05,9.015,23.016,21]tricosa-8,15(23),16,18,20-pentaen-7-one |
|---|---|
| PubChem CID | 146683213 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (1S,2R,5S,10S,13S)-10-hydroxy-1,2-dimethyl-6-oxa-22-azahexacyclo[11.10.0.02,10.05,9.015,23.016,21]tricosa-8,15(23),16,18,20-pentaen-7-one |
| SMILES | C[C@]12CC[C@@H]3OC(=O)C=C3[C@]1(O)CC[C@H]1Cc3c([nH]c4ccccc34)[C@@]12C |
| InChI | InChI=1S/C23H25NO3/c1-21-9-8-18-16(12-19(25)27-18)23(21,26)10-7-13-11-15-14-5-3-4-6-17(14)24-20(15)22(13,21)2/h3-6,12-13,18,24,26H,7-11H2,1-2H3/t13-,18-,21+,22+,23+/m0/s1 |
| InChIKey | NFTGNVPOAXTQOU-OSJOOWHZSA-N |
| XLogP | 3.77 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |