C32H41NO3 — CID 11960067
(1S,2R,7R,8R,11S)-1,2-dimethyl-20-(2-methylbut-3-en-2-yl)-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17(22),18,20-pentaene-8,11-diol (PubChem CID 11960067) has the molecular formula C32H41NO3 and a molecular weight of 487.68 g/mol. Its IUPAC name is (1S,2R,7R,8R,11S)-1,2-dimethyl-20-(2-methylbut-3-en-2-yl)-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17(22),18,20-pentaene-8,11-diol.
| Compound Name | (1S,2R,7R,8R,11S)-1,2-dimethyl-20-(2-methylbut-3-en-2-yl)-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17(22),18,20-pentaene-8,11-diol |
|---|---|
| PubChem CID | 11960067 |
| Molecular Formula | C32H41NO3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | (1S,2R,7R,8R,11S)-1,2-dimethyl-20-(2-methylbut-3-en-2-yl)-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17(22),18,20-pentaene-8,11-diol |
| SMILES | C=CC(C)(C)c1ccc2c3c([nH]c2c1)[C@@]1(C)C(CC[C@@]2(O)C4=C[C@@H](O)[C@@H](C(=C)C)OC4CC[C@@]21C)C3 |
| InChI | InChI=1S/C32H41NO3/c1-8-29(4,5)19-9-10-21-22-15-20-11-14-32(35)23-17-25(34)27(18(2)3)36-26(23)12-13-30(32,6)31(20,7)28(22)33-24(21)16-19/h8-10,16-17,20,25-27,33-35H,1-2,11-15H2,3-7H3/t20?,25-,26?,27-,30-,31-,32-/m1/s1 |
| InChIKey | XPYLFGPDHCCOLE-CEFGHSMWSA-N |
| XLogP | 6.02 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|