C28H35NO3 — CID 163049717
1,2-dimethyl-7-prop-1-en-2-yl-10-oxa-24-azaheptacyclo[13.10.0.02,12.05,11.09,11.017,25.018,23]pentacosa-17(25),18,20,22-tetraene-8,12-diol (PubChem CID 163049717) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 1,2-dimethyl-7-prop-1-en-2-yl-10-oxa-24-azaheptacyclo[13.10.0.02,12.05,11.09,11.017,25.018,23]pentacosa-17(25),18,20,22-tetraene-8,12-diol.
| Compound Name | 1,2-dimethyl-7-prop-1-en-2-yl-10-oxa-24-azaheptacyclo[13.10.0.02,12.05,11.09,11.017,25.018,23]pentacosa-17(25),18,20,22-tetraene-8,12-diol |
|---|---|
| PubChem CID | 163049717 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1,2-dimethyl-7-prop-1-en-2-yl-10-oxa-24-azaheptacyclo[13.10.0.02,12.05,11.09,11.017,25.018,23]pentacosa-17(25),18,20,22-tetraene-8,12-diol |
| SMILES | C=C(C)C1CC2CCC3(C)C4(C)c5[nH]c6ccccc6c5CC4CCC3(O)C23OC3C1O |
| InChI | InChI=1S/C28H35NO3/c1-15(2)19-14-17-9-11-25(3)26(4)16(10-12-27(25,31)28(17)24(32-28)22(19)30)13-20-18-7-5-6-8-21(18)29-23(20)26/h5-8,16-17,19,22,24,29-31H,1,9-14H2,2-4H3 |
| InChIKey | WZVVIQCDVXFOSY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|