C19H26O3 — CID 68670257
(8S,9R,10S,13S)-9-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,11,12-decahydrocyclopenta[a]phenanthrene-16,17-dione (PubChem CID 68670257) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (8S,9R,10S,13S)-9-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,11,12-decahydrocyclopenta[a]phenanthrene-16,17-dione.
| Compound Name | (8S,9R,10S,13S)-9-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,11,12-decahydrocyclopenta[a]phenanthrene-16,17-dione |
|---|---|
| PubChem CID | 68670257 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (8S,9R,10S,13S)-9-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,11,12-decahydrocyclopenta[a]phenanthrene-16,17-dione |
| SMILES | C[C@]12CC[C@@]3(O)[C@@H](CCC4CCCC[C@@]43C)C1=CC(=O)C2=O |
| InChI | InChI=1S/C19H26O3/c1-17-9-10-19(22)13(14(17)11-15(20)16(17)21)7-6-12-5-3-4-8-18(12,19)2/h11-13,22H,3-10H2,1-2H3/t12?,13-,17-,18-,19+/m0/s1 |
| InChIKey | UVPRSJJTQQOZFG-ZFWFHHEASA-N |
| XLogP | 3.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|