C7H13BrO — CID 129404972
cis-(1S,2S)-2-bromo-1-methylcyclohexan-1-ol (PubChem CID 129404972) has the molecular formula C7H13BrO and a molecular weight of 193.08 g/mol. Its IUPAC name is cis-(1S,2S)-2-bromo-1-methylcyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-bromo-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 129404972 |
| Molecular Formula | C7H13BrO |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | cis-(1S,2S)-2-bromo-1-methylcyclohexan-1-ol |
| SMILES | C[C@]1(O)CCCC[C@@H]1Br |
| InChI | InChI=1S/C7H13BrO/c1-7(9)5-3-2-4-6(7)8/h6,9H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | AEQDNPUUEODZSO-BQBZGAKWSA-N |
| XLogP | 2.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|