C12H19Br5O2 — CID 155920368
2,2,3,3,4-pentabromocyclododecane-1,1-diol (PubChem CID 155920368) has the molecular formula C12H19Br5O2 and a molecular weight of 594.80 g/mol. Its IUPAC name is 2,2,3,3,4-pentabromocyclododecane-1,1-diol.
| Compound Name | 2,2,3,3,4-pentabromocyclododecane-1,1-diol |
|---|---|
| PubChem CID | 155920368 |
| Molecular Formula | C12H19Br5O2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 589.73 |
| IUPAC Name | 2,2,3,3,4-pentabromocyclododecane-1,1-diol |
| SMILES | OC1(O)CCCCCCCCC(Br)C(Br)(Br)C1(Br)Br |
| InChI | InChI=1S/C12H19Br5O2/c13-9-7-5-3-1-2-4-6-8-10(18,19)12(16,17)11(9,14)15/h9,18-19H,1-8H2 |
| InChIKey | UZBQXGVTQLKUMR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|