C7H12BrF — CID 14433718
cis-(1R,2R)-2-bromo-1-fluoro-1-methylcyclohexane (PubChem CID 14433718) has the molecular formula C7H12BrF and a molecular weight of 195.07 g/mol. Its IUPAC name is cis-(1R,2R)-2-bromo-1-fluoro-1-methylcyclohexane.
| Compound Name | cis-(1R,2R)-2-bromo-1-fluoro-1-methylcyclohexane |
|---|---|
| PubChem CID | 14433718 |
| Molecular Formula | C7H12BrF |
| Molecular Weight | 195.07 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | cis-(1R,2R)-2-bromo-1-fluoro-1-methylcyclohexane |
| SMILES | C[C@@]1(F)CCCC[C@H]1Br |
| InChI | InChI=1S/C7H12BrF/c1-7(9)5-3-2-4-6(7)8/h6H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | UVMGGCBOZYPNRY-RNFRBKRXSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.07 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|