C10H17BrO2 — CID 98041196
(6R)-6-bromo-1,4-dioxaspiro[4.7]dodecane (PubChem CID 98041196) has the molecular formula C10H17BrO2 and a molecular weight of 249.15 g/mol. Its IUPAC name is (6R)-6-bromo-1,4-dioxaspiro[4.7]dodecane.
| Compound Name | (6R)-6-bromo-1,4-dioxaspiro[4.7]dodecane |
|---|---|
| PubChem CID | 98041196 |
| Molecular Formula | C10H17BrO2 |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (6R)-6-bromo-1,4-dioxaspiro[4.7]dodecane |
| SMILES | Br[C@@H]1CCCCCCC12OCCO2 |
| InChI | InChI=1S/C10H17BrO2/c11-9-5-3-1-2-4-6-10(9)12-7-8-13-10/h9H,1-8H2/t9-/m1/s1 |
| InChIKey | ROKQUFWISOAOIR-SECBINFHSA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|