C8H12O5 — CID 131133886
(3S,4S,5R)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-one (PubChem CID 131133886) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (3S,4S,5R)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-one.
| Compound Name | (3S,4S,5R)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 131133886 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (3S,4S,5R)-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-2-one |
| SMILES | O=C1O[C@]2(CCCCO2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12O5/c9-5-6(10)8(13-7(5)11)3-1-2-4-12-8/h5-6,9-10H,1-4H2/t5-,6-,8+/m0/s1 |
| InChIKey | KDKCXHFZNHRFIH-VMHSAVOQSA-N |
| XLogP | -0.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |