C13H26O3Si — CID 10083873
(1R)-1-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]-1-trimethylsilylethanol (PubChem CID 10083873) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (1R)-1-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]-1-trimethylsilylethanol.
| Compound Name | (1R)-1-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]-1-trimethylsilylethanol |
|---|---|
| PubChem CID | 10083873 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1R)-1-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]-1-trimethylsilylethanol |
| SMILES | C[C@](O)([C@H]1CCCCC12OCCO2)[Si](C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-12(14,17(2,3)4)11-7-5-6-8-13(11)15-9-10-16-13/h11,14H,5-10H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | GIWRIGQXJPHOJG-VXGBXAGGSA-N |
| XLogP | 2.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|