C12H21NO3 — CID 121001643
2-(1,4-dioxaspiro[4.5]decan-6-yl)-N,N-dimethylacetamide (PubChem CID 121001643) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-6-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(1,4-dioxaspiro[4.5]decan-6-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 121001643 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.5]decan-6-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CC1CCCCC12OCCO2 |
| InChI | InChI=1S/C12H21NO3/c1-13(2)11(14)9-10-5-3-4-6-12(10)15-7-8-16-12/h10H,3-9H2,1-2H3 |
| InChIKey | QLVCHFRTGRXFEK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |