C11H20N2O3 — CID 7336205
3-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]propanehydrazide (PubChem CID 7336205) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]propanehydrazide.
| Compound Name | 3-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]propanehydrazide |
|---|---|
| PubChem CID | 7336205 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-[(6S)-1,4-dioxaspiro[4.5]decan-6-yl]propanehydrazide |
| SMILES | NNC(=O)CC[C@@H]1CCCCC12OCCO2 |
| InChI | InChI=1S/C11H20N2O3/c12-13-10(14)5-4-9-3-1-2-6-11(9)15-7-8-16-11/h9H,1-8,12H2,(H,13,14)/t9-/m0/s1 |
| InChIKey | ZFDVKCIZYMNNTJ-VIFPVBQESA-N |
| XLogP | 0.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|