C15H22BrNO2 — CID 10903555
1-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)-4-methylpyridin-1-ium bromide (PubChem CID 10903555) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)-4-methylpyridin-1-ium bromide.
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)-4-methylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 10903555 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)-4-methylpyridin-1-ium bromide |
| SMILES | Cc1cc[n+](CC2CCCCC23OCCO3)cc1.[Br-] |
| InChI | InChI=1S/C15H22NO2.BrH/c1-13-5-8-16(9-6-13)12-14-4-2-3-7-15(14)17-10-11-18-15;/h5-6,8-9,14H,2-4,7,10-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | UMFQOMSXLXXQHS-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|