C10H18O4 — CID 124672672
(9S)-9-(methoxymethoxymethyl)-1,4-dioxaspiro[4.4]nonane (PubChem CID 124672672) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (9S)-9-(methoxymethoxymethyl)-1,4-dioxaspiro[4.4]nonane.
| Compound Name | (9S)-9-(methoxymethoxymethyl)-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 124672672 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (9S)-9-(methoxymethoxymethyl)-1,4-dioxaspiro[4.4]nonane |
| SMILES | COCOC[C@@H]1CCCC12OCCO2 |
| InChI | InChI=1S/C10H18O4/c1-11-8-12-7-9-3-2-4-10(9)13-5-6-14-10/h9H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | ASEOJRFGOITWEX-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|