C10H16N2O4 — CID 124672662
(5R,9S)-9-(methoxymethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 124672662) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (5R,9S)-9-(methoxymethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,9S)-9-(methoxymethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 124672662 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (5R,9S)-9-(methoxymethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | COCOC[C@H]1CCC[C@@]12NC(=O)NC2=O |
| InChI | InChI=1S/C10H16N2O4/c1-15-6-16-5-7-3-2-4-10(7)8(13)11-9(14)12-10/h7H,2-6H2,1H3,(H2,11,12,13,14)/t7-,10-/m1/s1 |
| InChIKey | SJXOQHLJYZXLLP-GMSGAONNSA-N |
| XLogP | -0.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|