C14H15Cl2N3O4S — CID 97076287
3,5-dichloro-N-[[(5R,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]benzenesulfonamide (PubChem CID 97076287) has the molecular formula C14H15Cl2N3O4S and a molecular weight of 392.26 g/mol. Its IUPAC name is 3,5-dichloro-N-[[(5R,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[[(5R,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97076287 |
| Molecular Formula | C14H15Cl2N3O4S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 3,5-dichloro-N-[[(5R,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]benzenesulfonamide |
| SMILES | O=C1NC(=O)[C@]2(CCC[C@H]2CNS(=O)(=O)c2cc(Cl)cc(Cl)c2)N1 |
| InChI | InChI=1S/C14H15Cl2N3O4S/c15-9-4-10(16)6-11(5-9)24(22,23)17-7-8-2-1-3-14(8)12(20)18-13(21)19-14/h4-6,8,17H,1-3,7H2,(H2,18,19,20,21)/t8-,14+/m0/s1 |
| InChIKey | HYHAGSMUVDWZIW-RMLUDKJBSA-N |
| XLogP | 1.65 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|