C15H18BrN3O4S — CID 97068150
4-bromo-N-[[(5S,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-methylbenzenesulfonamide (PubChem CID 97068150) has the molecular formula C15H18BrN3O4S and a molecular weight of 416.30 g/mol. Its IUPAC name is 4-bromo-N-[[(5S,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[[(5S,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 97068150 |
| Molecular Formula | C15H18BrN3O4S |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 4-bromo-N-[[(5S,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC[C@H]2CCC[C@]23NC(=O)NC3=O)ccc1Br |
| InChI | InChI=1S/C15H18BrN3O4S/c1-9-7-11(4-5-12(9)16)24(22,23)17-8-10-3-2-6-15(10)13(20)18-14(21)19-15/h4-5,7,10,17H,2-3,6,8H2,1H3,(H2,18,19,20,21)/t10-,15+/m1/s1 |
| InChIKey | KAWFFLZESMXPBO-BMIGLBTASA-N |
| XLogP | 1.41 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|