C8H13N3O2 — CID 95566914
(5R,9R)-9-(aminomethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 95566914) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (5R,9R)-9-(aminomethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,9R)-9-(aminomethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 95566914 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (5R,9R)-9-(aminomethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | NC[C@H]1CCC[C@@]12NC(=O)NC2=O |
| InChI | InChI=1S/C8H13N3O2/c9-4-5-2-1-3-8(5)6(12)10-7(13)11-8/h5H,1-4,9H2,(H2,10,11,12,13)/t5-,8-/m1/s1 |
| InChIKey | JHUGQAVXQZPQSX-SVGQVSJJSA-N |
| XLogP | -0.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|