C14H18N4O4 — CID 86769507
1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(furan-2-ylmethyl)urea (PubChem CID 86769507) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 86769507 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(furan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccco1)NCC1CCCC12NC(=O)NC2=O |
| InChI | InChI=1S/C14H18N4O4/c19-11-14(18-13(21)17-11)5-1-3-9(14)7-15-12(20)16-8-10-4-2-6-22-10/h2,4,6,9H,1,3,5,7-8H2,(H2,15,16,20)(H2,17,18,19,21) |
| InChIKey | USZLQXWLHUZDKG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|