C19H23N3O3 — CID 128555479
N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-7-methyl-2,3-dihydro-1H-indene-4-carboxamide (PubChem CID 128555479) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-7-methyl-2,3-dihydro-1H-indene-4-carboxamide.
| Compound Name | N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-7-methyl-2,3-dihydro-1H-indene-4-carboxamide |
|---|---|
| PubChem CID | 128555479 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-7-methyl-2,3-dihydro-1H-indene-4-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC2CCCC23NC(=O)NC3=O)c2c1CCC2 |
| InChI | InChI=1S/C19H23N3O3/c1-11-7-8-15(14-6-2-5-13(11)14)16(23)20-10-12-4-3-9-19(12)17(24)21-18(25)22-19/h7-8,12H,2-6,9-10H2,1H3,(H,20,23)(H2,21,22,24,25) |
| InChIKey | AQWFPDWUCGGGFX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|