C18H24N4O3 — CID 124615846
1-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-(3-ethyl-4-methylphenyl)urea (PubChem CID 124615846) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-(3-ethyl-4-methylphenyl)urea.
| Compound Name | 1-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-(3-ethyl-4-methylphenyl)urea |
|---|---|
| PubChem CID | 124615846 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-3-(3-ethyl-4-methylphenyl)urea |
| SMILES | CCc1cc(NC(=O)NC[C@@H]2CCC[C@]23NC(=O)NC3=O)ccc1C |
| InChI | InChI=1S/C18H24N4O3/c1-3-12-9-14(7-6-11(12)2)20-16(24)19-10-13-5-4-8-18(13)15(23)21-17(25)22-18/h6-7,9,13H,3-5,8,10H2,1-2H3,(H2,19,20,24)(H2,21,22,23,25)/t13-,18-/m0/s1 |
| InChIKey | WJSATKRZDOKTHY-UGSOOPFHSA-N |
| XLogP | 2.06 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|