C17H17N3O3S — CID 124884132
N-[[(5R,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-benzothiophene-5-carboxamide (PubChem CID 124884132) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[[(5R,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-benzothiophene-5-carboxamide.
| Compound Name | N-[[(5R,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 124884132 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[[(5R,9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-benzothiophene-5-carboxamide |
| SMILES | O=C1NC(=O)[C@]2(CCC[C@@H]2CNC(=O)c2ccc3sccc3c2)N1 |
| InChI | InChI=1S/C17H17N3O3S/c21-14(11-3-4-13-10(8-11)5-7-24-13)18-9-12-2-1-6-17(12)15(22)19-16(23)20-17/h3-5,7-8,12H,1-2,6,9H2,(H,18,21)(H2,19,20,22,23)/t12-,17-/m1/s1 |
| InChIKey | WZHUUIZBASOUPM-SJKOYZFVSA-N |
| XLogP | 2.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|