C20H24N4O3 — CID 97099072
N-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-propylindole-3-carboxamide (PubChem CID 97099072) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-propylindole-3-carboxamide.
| Compound Name | N-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-propylindole-3-carboxamide |
|---|---|
| PubChem CID | 97099072 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[[(5S,9S)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]methyl]-1-propylindole-3-carboxamide |
| SMILES | CCCn1cc(C(=O)NC[C@@H]2CCC[C@]23NC(=O)NC3=O)c2ccccc21 |
| InChI | InChI=1S/C20H24N4O3/c1-2-10-24-12-15(14-7-3-4-8-16(14)24)17(25)21-11-13-6-5-9-20(13)18(26)22-19(27)23-20/h3-4,7-8,12-13H,2,5-6,9-11H2,1H3,(H,21,25)(H2,22,23,26,27)/t13-,20-/m0/s1 |
| InChIKey | DLEXOLJMMGUNRA-RBZFPXEDSA-N |
| XLogP | 2.16 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|