C14H19N3O3S — CID 51102367
1-propyl-N-(2-sulfamoylethyl)indole-3-carboxamide (PubChem CID 51102367) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-propyl-N-(2-sulfamoylethyl)indole-3-carboxamide.
| Compound Name | 1-propyl-N-(2-sulfamoylethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 51102367 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-propyl-N-(2-sulfamoylethyl)indole-3-carboxamide |
| SMILES | CCCn1cc(C(=O)NCCS(N)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C14H19N3O3S/c1-2-8-17-10-12(11-5-3-4-6-13(11)17)14(18)16-7-9-21(15,19)20/h3-6,10H,2,7-9H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | JCMYIGMCQAXFIA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |