C21H30N2O — CID 58011311
N-(cycloheptylmethyl)-4-methyl-1-propylindole-3-carboxamide (PubChem CID 58011311) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-4-methyl-1-propylindole-3-carboxamide.
| Compound Name | N-(cycloheptylmethyl)-4-methyl-1-propylindole-3-carboxamide |
|---|---|
| PubChem CID | 58011311 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-(cycloheptylmethyl)-4-methyl-1-propylindole-3-carboxamide |
| SMILES | CCCn1cc(C(=O)NCC2CCCCCC2)c2c(C)cccc21 |
| InChI | InChI=1S/C21H30N2O/c1-3-13-23-15-18(20-16(2)9-8-12-19(20)23)21(24)22-14-17-10-6-4-5-7-11-17/h8-9,12,15,17H,3-7,10-11,13-14H2,1-2H3,(H,22,24) |
| InChIKey | NISYFUMDTSRAAS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |