C19H24Cl2N2O — CID 58011331
4,6-dichloro-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide (PubChem CID 58011331) has the molecular formula C19H24Cl2N2O and a molecular weight of 367.32 g/mol. Its IUPAC name is 4,6-dichloro-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide.
| Compound Name | 4,6-dichloro-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide |
|---|---|
| PubChem CID | 58011331 |
| Molecular Formula | C19H24Cl2N2O |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4,6-dichloro-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCC2CCCCCC2)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C19H24Cl2N2O/c1-2-23-12-15(18-16(21)9-14(20)10-17(18)23)19(24)22-11-13-7-5-3-4-6-8-13/h9-10,12-13H,2-8,11H2,1H3,(H,22,24) |
| InChIKey | XWOUFHCXNOFGKE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |