C19H25BrN2O — CID 58011456
4-bromo-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide (PubChem CID 58011456) has the molecular formula C19H25BrN2O and a molecular weight of 377.33 g/mol. Its IUPAC name is 4-bromo-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide.
| Compound Name | 4-bromo-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide |
|---|---|
| PubChem CID | 58011456 |
| Molecular Formula | C19H25BrN2O |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-bromo-N-(cycloheptylmethyl)-1-ethylindole-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCC2CCCCCC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C19H25BrN2O/c1-2-22-13-15(18-16(20)10-7-11-17(18)22)19(23)21-12-14-8-5-3-4-6-9-14/h7,10-11,13-14H,2-6,8-9,12H2,1H3,(H,21,23) |
| InChIKey | BHQVNWYBKYWFJN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |