C19H24BBrN2O — CID 89144935
CID 89144935 (PubChem CID 89144935) has the molecular formula C19H24BBrN2O and a molecular weight of 387.13 g/mol.
| Compound Name | CID 89144935 |
|---|---|
| PubChem CID | 89144935 |
| Molecular Formula | C19H24BBrN2O |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Br)cc2c1c(C(=O)NCC1CCCCCC1)cn2CC |
| InChI | InChI=1S/C19H24BBrN2O/c1-2-23-12-15(18-16(20)9-14(21)10-17(18)23)19(24)22-11-13-7-5-3-4-6-8-13/h9-10,12-13H,2-8,11H2,1H3,(H,22,24) |
| InChIKey | KFERKNPXGZMJQM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|