C17H22BN3O — CID 89150543
CID 89150543 (PubChem CID 89150543) has the molecular formula C17H22BN3O and a molecular weight of 295.19 g/mol.
| Compound Name | CID 89150543 |
|---|---|
| PubChem CID | 89150543 |
| Molecular Formula | C17H22BN3O |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | — |
| SMILES | [B]c1cncc2c1c(C(=O)NCC1CCCCCC1)cn2C |
| InChI | InChI=1S/C17H22BN3O/c1-21-11-13(16-14(18)9-19-10-15(16)21)17(22)20-8-12-6-4-2-3-5-7-12/h9-12H,2-8H2,1H3,(H,20,22) |
| InChIKey | KFDIGDZQTPGGFL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|