C19H24ClFN2O2 — CID 58011385
6-chloro-N-(cycloheptylmethyl)-4-fluoro-1-(2-hydroxyethyl)indole-3-carboxamide (PubChem CID 58011385) has the molecular formula C19H24ClFN2O2 and a molecular weight of 366.86 g/mol. Its IUPAC name is 6-chloro-N-(cycloheptylmethyl)-4-fluoro-1-(2-hydroxyethyl)indole-3-carboxamide.
| Compound Name | 6-chloro-N-(cycloheptylmethyl)-4-fluoro-1-(2-hydroxyethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 58011385 |
| Molecular Formula | C19H24ClFN2O2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 6-chloro-N-(cycloheptylmethyl)-4-fluoro-1-(2-hydroxyethyl)indole-3-carboxamide |
| SMILES | O=C(NCC1CCCCCC1)c1cn(CCO)c2cc(Cl)cc(F)c12 |
| InChI | InChI=1S/C19H24ClFN2O2/c20-14-9-16(21)18-15(12-23(7-8-24)17(18)10-14)19(25)22-11-13-5-3-1-2-4-6-13/h9-10,12-13,24H,1-8,11H2,(H,22,25) |
| InChIKey | WXVCAQLUYFCEKG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |