C20H27BrN2O2 — CID 58011335
4-bromo-N-(2-cycloheptylethyl)-1-(2-hydroxyethyl)indole-3-carboxamide (PubChem CID 58011335) has the molecular formula C20H27BrN2O2 and a molecular weight of 407.35 g/mol. Its IUPAC name is 4-bromo-N-(2-cycloheptylethyl)-1-(2-hydroxyethyl)indole-3-carboxamide.
| Compound Name | 4-bromo-N-(2-cycloheptylethyl)-1-(2-hydroxyethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 58011335 |
| Molecular Formula | C20H27BrN2O2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-bromo-N-(2-cycloheptylethyl)-1-(2-hydroxyethyl)indole-3-carboxamide |
| SMILES | O=C(NCCC1CCCCCC1)c1cn(CCO)c2cccc(Br)c12 |
| InChI | InChI=1S/C20H27BrN2O2/c21-17-8-5-9-18-19(17)16(14-23(18)12-13-24)20(25)22-11-10-15-6-3-1-2-4-7-15/h5,8-9,14-15,24H,1-4,6-7,10-13H2,(H,22,25) |
| InChIKey | FXEFZJGVLOMBFZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |