C23H31BrN2O2 — CID 71077172
4-bromo-N-(2-cycloheptylethyl)-1-[2-(oxetan-3-yl)ethyl]indole-3-carboxamide (PubChem CID 71077172) has the molecular formula C23H31BrN2O2 and a molecular weight of 447.42 g/mol. Its IUPAC name is 4-bromo-N-(2-cycloheptylethyl)-1-[2-(oxetan-3-yl)ethyl]indole-3-carboxamide.
| Compound Name | 4-bromo-N-(2-cycloheptylethyl)-1-[2-(oxetan-3-yl)ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 71077172 |
| Molecular Formula | C23H31BrN2O2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-bromo-N-(2-cycloheptylethyl)-1-[2-(oxetan-3-yl)ethyl]indole-3-carboxamide |
| SMILES | O=C(NCCC1CCCCCC1)c1cn(CCC2COC2)c2cccc(Br)c12 |
| InChI | InChI=1S/C23H31BrN2O2/c24-20-8-5-9-21-22(20)19(14-26(21)13-11-18-15-28-16-18)23(27)25-12-10-17-6-3-1-2-4-7-17/h5,8-9,14,17-18H,1-4,6-7,10-13,15-16H2,(H,25,27) |
| InChIKey | RTEAMXWKNAQBOL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |