C15H20N4O3S — CID 136574540
1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-[(4-methylthiophen-2-yl)methyl]urea (PubChem CID 136574540) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-[(4-methylthiophen-2-yl)methyl]urea.
| Compound Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-[(4-methylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 136574540 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-[(4-methylthiophen-2-yl)methyl]urea |
| SMILES | Cc1csc(CNC(=O)NCC2CCCC23NC(=O)NC3=O)c1 |
| InChI | InChI=1S/C15H20N4O3S/c1-9-5-11(23-8-9)7-17-13(21)16-6-10-3-2-4-15(10)12(20)18-14(22)19-15/h5,8,10H,2-4,6-7H2,1H3,(H2,16,17,21)(H2,18,19,20,22) |
| InChIKey | YYFNULCJOIWGEE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|