C11H13ClFNO4S — CID 126824889
3-chloro-N-(1,3-dioxan-2-ylmethyl)-5-fluorobenzenesulfonamide (PubChem CID 126824889) has the molecular formula C11H13ClFNO4S and a molecular weight of 309.75 g/mol. Its IUPAC name is 3-chloro-N-(1,3-dioxan-2-ylmethyl)-5-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-(1,3-dioxan-2-ylmethyl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 126824889 |
| Molecular Formula | C11H13ClFNO4S |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3-chloro-N-(1,3-dioxan-2-ylmethyl)-5-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1OCCCO1)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C11H13ClFNO4S/c12-8-4-9(13)6-10(5-8)19(15,16)14-7-11-17-2-1-3-18-11/h4-6,11,14H,1-3,7H2 |
| InChIKey | XTZUAKMVFPLLLJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |